Cyclo(L-leucyl-L-valyl) structure
|
Common Name | Cyclo(L-leucyl-L-valyl) | ||
|---|---|---|---|---|
| CAS Number | 15136-24-0 | Molecular Weight | 212.29 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C11H20N2O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of Cyclo(L-leucyl-L-valyl)Cyclo(L-leucyl-L-valyl) inhibits Aflatoxin production by Aspergillus parasiticus.Cyclo(L-leucyl-L-valyl) inhibits transcription of the Aflatoxin-related genes aflR, hexB, pksL1, and dmtA.[1]. |
| Name | (3S,6S)-3-(2-methylpropyl)-6-propan-2-ylpiperazine-2,5-dione |
|---|---|
| Synonym | More Synonyms |
| Description | Cyclo(L-leucyl-L-valyl) inhibits Aflatoxin production by Aspergillus parasiticus.Cyclo(L-leucyl-L-valyl) inhibits transcription of the Aflatoxin-related genes aflR, hexB, pksL1, and dmtA.[1]. |
|---|---|
| Related Catalog | |
| References |
| Molecular Formula | C11H20N2O2 |
|---|---|
| Molecular Weight | 212.29 |
| Exact Mass | 212.15200 |
| PSA | 65.18000 |
| LogP | 1.22350 |
| InChIKey | UPOUGDHEEGKEGS-IUCAKERBSA-N |
| SMILES | CC(C)CC1NC(=O)C(C(C)C)NC1=O |
| cyclo-Leu-Val |