Ciclactate structure
|
Common Name | Ciclactate | ||
|---|---|---|---|---|
| CAS Number | 15145-14-9 | Molecular Weight | 214.30100 | |
| Density | 1.01g/cm3 | Boiling Point | 280.9ºC at 760 mmHg | |
| Molecular Formula | C12H22O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 106.3ºC | |
| Name | Ciclactate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.01g/cm3 |
|---|---|
| Boiling Point | 280.9ºC at 760 mmHg |
| Molecular Formula | C12H22O3 |
| Molecular Weight | 214.30100 |
| Flash Point | 106.3ºC |
| Exact Mass | 214.15700 |
| PSA | 46.53000 |
| LogP | 2.12520 |
| Vapour Pressure | 0.00044mmHg at 25°C |
| Index of Refraction | 1.469 |
| InChIKey | SRJOJNGMYPRTOL-UHFFFAOYSA-N |
| SMILES | CC1CC(OC(=O)C(C)O)CC(C)(C)C1 |
| HS Code | 2918110000 |
|---|
| HS Code | 2918110000 |
|---|---|
| Summary | 2918110000. lactic acid, its salts and esters. VAT:17.0%. Tax rebate rate:13.0%. Supervision conditions:AB(certificate of inspection for goods inward,certificate of inspection for goods outward). MFN tariff:6.5%. General tariff:30.0% |
| 2-Hydroxypropanoic acid 3,3,5-trimethylcyclohexyl ester |
| 2-Hydroxypropionic acid 3,3,5-trimethylcyclohexyl ester |