Urea,N-(2-chloroethyl)-N'-(2-methoxyphenyl)-N-nitroso- structure
|
Common Name | Urea,N-(2-chloroethyl)-N'-(2-methoxyphenyl)-N-nitroso- | ||
|---|---|---|---|---|
| CAS Number | 15145-41-2 | Molecular Weight | 257.67400 | |
| Density | 1.32g/cm3 | Boiling Point | N/A | |
| Molecular Formula | C10H12ClN3O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | Urea,N-(2-chloroethyl)-N'-(2-methoxyphenyl)-N-nitroso |
|---|
| Density | 1.32g/cm3 |
|---|---|
| Molecular Formula | C10H12ClN3O3 |
| Molecular Weight | 257.67400 |
| Exact Mass | 257.05700 |
| PSA | 71.00000 |
| LogP | 2.52230 |
| Index of Refraction | 1.567 |
| InChIKey | OLWGIKPHCGRTPE-UHFFFAOYSA-N |
| SMILES | COc1ccccc1NC(=O)N(CCCl)N=O |
| HS Code | 2924299090 |
|---|
| HS Code | 2924299090 |
|---|---|
| Summary | 2924299090. other cyclic amides (including cyclic carbamates) and their derivatives; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |