Ampelopsin F structure
|
Common Name | Ampelopsin F | ||
|---|---|---|---|---|
| CAS Number | 151487-08-0 | Molecular Weight | 454.471 | |
| Density | 1.5±0.1 g/cm3 | Boiling Point | 703.8±60.0 °C at 760 mmHg | |
| Molecular Formula | C28H22O6 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 315.8±27.5 °C | |
Use of Ampelopsin FAmpelopsins F is a bridged plant oligostilbene that can be isolated from Ampelopsis brevipedunculata var. hancei roots. Ampelopsins F is a resveratrol dimer[1]. |
| Name | Ampelopsin F |
|---|---|
| Synonym | More Synonyms |
| Description | Ampelopsins F is a bridged plant oligostilbene that can be isolated from Ampelopsis brevipedunculata var. hancei roots. Ampelopsins F is a resveratrol dimer[1]. |
|---|---|
| Related Catalog | |
| References |
| Density | 1.5±0.1 g/cm3 |
|---|---|
| Boiling Point | 703.8±60.0 °C at 760 mmHg |
| Molecular Formula | C28H22O6 |
| Molecular Weight | 454.471 |
| Flash Point | 315.8±27.5 °C |
| Exact Mass | 454.141632 |
| LogP | 3.91 |
| Vapour Pressure | 0.0±2.3 mmHg at 25°C |
| Index of Refraction | 1.775 |
| InChIKey | LJHNYAXAPRDORG-CDORBJOZSA-N |
| SMILES | Oc1ccc(C2c3c(O)cc(O)cc3C3c4c(O)cc(O)cc4C2C3c2ccc(O)cc2)cc1 |
| (1R,8R,9S,16R)-8,16-Bis(4-hydroxyphenyl)tetracyclo[7.6.1.02,7.010,15]hexadeca-2,4,6,10,12,14-hexaene-4,6,12,14-tetrol |
| 5,10-Methano-5H-dibenzo[a,d]cycloheptene-1,3,6,8-tetrol, 10,11-dihydro-11,12-bis(4-hydroxyphenyl)-, (5R,10S,11R,12R)- |