5-[3-(Dipropylamino)propoxy]-3-methyl-1-phenyl-1H-pyrazole structure
|
Common Name | 5-[3-(Dipropylamino)propoxy]-3-methyl-1-phenyl-1H-pyrazole | ||
|---|---|---|---|---|
| CAS Number | 15150-37-5 | Molecular Weight | 315.45300 | |
| Density | 1.01g/cm3 | Boiling Point | 440.7ºC at 760mmHg | |
| Molecular Formula | C19H29N3O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 220.3ºC | |
| Name | 3-(5-methyl-2-phenylpyrazol-3-yl)oxy-N,N-dipropylpropan-1-amine |
|---|
| Density | 1.01g/cm3 |
|---|---|
| Boiling Point | 440.7ºC at 760mmHg |
| Molecular Formula | C19H29N3O |
| Molecular Weight | 315.45300 |
| Flash Point | 220.3ºC |
| Exact Mass | 315.23100 |
| PSA | 30.29000 |
| LogP | 4.07160 |
| Vapour Pressure | 5.79E-08mmHg at 25°C |
| Index of Refraction | 1.533 |
| InChIKey | PWMDWKQYJHABFV-UHFFFAOYSA-N |
| SMILES | CCCN(CCC)CCCOc1cc(C)nn1-c1ccccc1 |
| HS Code | 2933199090 |
|---|
| HS Code | 2933199090 |
|---|---|
| Summary | 2933199090. other compounds containing an unfused pyrazole ring (whether or not hydrogenated) in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |