8-[(E)-2-(3-nitrophenyl)ethenyl]-1,3-dipropyl-7H-purine-2,6-dione structure
|
Common Name | 8-[(E)-2-(3-nitrophenyl)ethenyl]-1,3-dipropyl-7H-purine-2,6-dione | ||
|---|---|---|---|---|
| CAS Number | 151539-32-1 | Molecular Weight | 383.40100 | |
| Density | 1.339g/cm3 | Boiling Point | 629ºC at 760mmHg | |
| Molecular Formula | C19H21N5O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 334.2ºC | |
| Name | 8-[(E)-2-(3-nitrophenyl)ethenyl]-1,3-dipropyl-7H-purine-2,6-dione |
|---|
| Density | 1.339g/cm3 |
|---|---|
| Boiling Point | 629ºC at 760mmHg |
| Molecular Formula | C19H21N5O4 |
| Molecular Weight | 383.40100 |
| Flash Point | 334.2ºC |
| Exact Mass | 383.15900 |
| PSA | 118.50000 |
| LogP | 3.30810 |
| Vapour Pressure | 9.8E-16mmHg at 25°C |
| Index of Refraction | 1.659 |
| InChIKey | OQURVXLRSYSXCY-CMDGGOBGSA-N |
| SMILES | CCCn1c(=O)c2[nH]c(C=Cc3cccc([N+](=O)[O-])c3)nc2n(CCC)c1=O |
|
~%
8-[(E)-2-(3-nit... CAS#:151539-32-1 |
| Literature: Jacobson; Gallo-Rodriguez; Melman; Fischer; Maillard; Van Bergen; Van Galen; Karton Journal of Medicinal Chemistry, 1993 , vol. 36, # 10 p. 1333 - 1342 |
|
~%
8-[(E)-2-(3-nit... CAS#:151539-32-1 |
| Literature: Jacobson; Gallo-Rodriguez; Melman; Fischer; Maillard; Van Bergen; Van Galen; Karton Journal of Medicinal Chemistry, 1993 , vol. 36, # 10 p. 1333 - 1342 |
| Precursor 2 | |
|---|---|
| DownStream 1 | |