Long trebler phosphoramidite
Modify Date: 2025-08-25 20:39:44
Long trebler phosphoramidite structure
|
Common Name | Long trebler phosphoramidite | ||
|---|---|---|---|---|
| CAS Number | 1516489-83-0 | Molecular Weight | 1475.81 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C89H107N2O15P | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of Long trebler phosphoramiditeLong trebler phosphoramidite is a branching reagent for oligonucleotide synthesis allowing to synthesize branched DNA structures using a standard DNA synthesizer.Trebler amidite can be used to attach several modifier amidites to the 5'-end of an oligonucleotide - for example, three biotin residues can be attached at once. |
| Name | Long trebler phosphoramidite |
|---|
| Description | Long trebler phosphoramidite is a branching reagent for oligonucleotide synthesis allowing to synthesize branched DNA structures using a standard DNA synthesizer.Trebler amidite can be used to attach several modifier amidites to the 5'-end of an oligonucleotide - for example, three biotin residues can be attached at once. |
|---|
| Molecular Formula | C89H107N2O15P |
|---|---|
| Molecular Weight | 1475.81 |
| InChIKey | GLIQPXBAWPTSHZ-UHFFFAOYSA-N |
| SMILES | COc1ccc(C(OCCCOCC(COCCCOP(OCCC#N)N(C(C)C)C(C)C)(COCCCOC(c2ccccc2)(c2ccc(OC)cc2)c2ccc(OC)cc2)COCCCOC(c2ccccc2)(c2ccc(OC)cc2)c2ccc(OC)cc2)(c2ccccc2)c2ccc(OC)cc2)cc1 |