1-(6,7-dimethoxy-2H-benzo[d]1,3-dioxolan-5-yl)prop-2-ylamine structure
|
Common Name | 1-(6,7-dimethoxy-2H-benzo[d]1,3-dioxolan-5-yl)prop-2-ylamine | ||
|---|---|---|---|---|
| CAS Number | 15183-26-3 | Molecular Weight | 239.26800 | |
| Density | 1.184g/cm3 | Boiling Point | 325.4ºC at 760 mmHg | |
| Molecular Formula | C12H17NO4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 153.5ºC | |
| Name | 1-(6,7-dimethoxy-1,3-benzodioxol-5-yl)propan-2-amine |
|---|---|
| Synonym | More Synonyms |
| Density | 1.184g/cm3 |
|---|---|
| Boiling Point | 325.4ºC at 760 mmHg |
| Molecular Formula | C12H17NO4 |
| Molecular Weight | 239.26800 |
| Flash Point | 153.5ºC |
| Exact Mass | 239.11600 |
| PSA | 62.94000 |
| LogP | 2.02250 |
| Vapour Pressure | 0.00023mmHg at 25°C |
| Index of Refraction | 1.54 |
| InChIKey | UQXNREZPUUGSKM-UHFFFAOYSA-N |
| SMILES | COc1c(CC(C)N)cc2c(c1OC)OCO2 |
| HS Code | 2932999099 |
|---|
| HS Code | 2932999099 |
|---|---|
| Summary | 2932999099. other heterocyclic compounds with oxygen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 1-(6,7-dimethoxy-2H-benzo[d]1,3-dioxolan-5-yl)prop-2-ylamine |
| 2,3-Dimethoxy-4,5-methylenedioxyamphetamine |
| 1-(6,7-Dimethoxybenzo[d][1,3]dioxol-5-yl)propan-2-amine |
| 2,3-dimethoxy-4,5-methylenedioxyphenylisopropylamine |