Scytonemin structure
|
Common Name | Scytonemin | ||
|---|---|---|---|---|
| CAS Number | 152075-98-4 | Molecular Weight | 544.55500 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C36H20N2O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of ScytoneminScytonemin is an ultraviolet sunscreen pigment, that can be isolated from the sheaths of cyanobacteria. Scytonemin displays multiple roles, functioning as a potent UV sunscreen and antioxidant molecules, and can be exploited in cosmetic and other industries for the development of new cosmeceuticals[1]. |
| Name | 3-[(4-oxocyclohexa-2,5-dien-1-ylidene)methyl]-1-[2-oxo-3-[(4-oxocyclohexa-2,5-dien-1-ylidene)methyl]-4H-cyclopenta[b]indol-1-yl]-4H-cyclopenta[b]indol-2-one |
|---|---|
| Synonym | More Synonyms |
| Description | Scytonemin is an ultraviolet sunscreen pigment, that can be isolated from the sheaths of cyanobacteria. Scytonemin displays multiple roles, functioning as a potent UV sunscreen and antioxidant molecules, and can be exploited in cosmetic and other industries for the development of new cosmeceuticals[1]. |
|---|---|
| Related Catalog | |
| References |
| Molecular Formula | C36H20N2O4 |
|---|---|
| Molecular Weight | 544.55500 |
| Exact Mass | 544.14200 |
| PSA | 99.32000 |
| LogP | 5.68120 |
| InChIKey | CGZKSPLDUIRCIO-RPCRKUJJSA-N |
| SMILES | O=C1C(=Cc2ccc(O)cc2)C2=Nc3ccccc3C2=C1C1=C2C(=Nc3ccccc32)C(=Cc2ccc(O)cc2)C1=O |
| Scytonemin,Lyngbya sp. |
| HMS3229P05 |
| SCY |
| (1,1'-Bicyclopent(b)indole)-2,2'(3H,3'H)-dione,3,3'-bis((4-hydroxyphenyl)methylene) |
| 3,3'-Bis((4-hydroxyphenyl)methylene)-(1,1'-bicyclopent(b)indole)-2,2'(3H,3'H)-dione |