5-chloro-1,3-dimethyl-1H-indole-2-carboxylic acid structure
|
Common Name | 5-chloro-1,3-dimethyl-1H-indole-2-carboxylic acid | ||
|---|---|---|---|---|
| CAS Number | 152088-13-6 | Molecular Weight | 223.65600 | |
| Density | 1.35g/cm3 | Boiling Point | 423.7ºC at 760 mmHg | |
| Molecular Formula | C11H10ClNO2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 210ºC | |
| Name | 5-chloro-1,3-dimethylindole-2-carboxylic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.35g/cm3 |
|---|---|
| Boiling Point | 423.7ºC at 760 mmHg |
| Molecular Formula | C11H10ClNO2 |
| Molecular Weight | 223.65600 |
| Flash Point | 210ºC |
| Exact Mass | 223.04000 |
| PSA | 42.23000 |
| LogP | 2.83830 |
| Vapour Pressure | 6.19E-08mmHg at 25°C |
| Index of Refraction | 1.618 |
| InChIKey | YWHLWJBYLZEDNM-UHFFFAOYSA-N |
| SMILES | Cc1c(C(=O)O)n(C)c2ccc(Cl)cc12 |
| HS Code | 2933990090 |
|---|
| HS Code | 2933990090 |
|---|---|
| Summary | 2933990090. heterocyclic compounds with nitrogen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 1,3-dimethyl-5-chloroindole 2-carboxylic acid |
| 5-Chloro-1,3-dimethyl-1H-indole-2-carboxylic acid |