1,2,4-Triazolo[4,3-b]pyridazin-3(2H)-one, 6-(2-amino-1-methylpropyl)
Modify Date: 2026-07-19 10:18:55
![1,2,4-Triazolo[4,3-b]pyridazin-3(2H)-one, 6-(2-amino-1-methylpropyl) Structure](https://www.chemsrc.com/extcaspic/094/1521237-93-3.png)
1,2,4-Triazolo[4,3-b]pyridazin-3(2H)-one, 6-(2-amino-1-methylpropyl) structure
|
Common Name | 1,2,4-Triazolo[4,3-b]pyridazin-3(2H)-one, 6-(2-amino-1-methylpropyl) | ||
|---|---|---|---|---|
| CAS Number | 1521237-93-3 | Molecular Weight | 207.23 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C9H13N5O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 1,2,4-Triazolo[4,3-b]pyridazin-3(2H)-one, 6-(2-amino-1-methylpropyl) |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C9H13N5O |
|---|---|
| Molecular Weight | 207.23 |
| InChIKey | OCDJXJKVXZUELG-UHFFFAOYSA-N |
| SMILES | CC(N)C(C)c1ccc2n[nH]c(=O)n2n1 |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the molecular formula of 1,2,4-Triazolo[4,3-b]pyridazin-3(2H)-one, 6-(2-amino-1-methylpropyl)? |
| A: Molecular formula of 1,2,4-Triazolo[4,3-b]pyridazin-3(2H)-one, 6-(2-amino-1-methylpropyl) is C9H13N5O. |
| Q: What is the molecular weight of 1,2,4-Triazolo[4,3-b]pyridazin-3(2H)-one, 6-(2-amino-1-methylpropyl)? |
| A: Molecular weight of 1,2,4-Triazolo[4,3-b]pyridazin-3(2H)-one, 6-(2-amino-1-methylpropyl) is 207.23. |
| Q: What is the CAS number of 1,2,4-Triazolo[4,3-b]pyridazin-3(2H)-one, 6-(2-amino-1-methylpropyl)? |
| A: CAS number of 1,2,4-Triazolo[4,3-b]pyridazin-3(2H)-one, 6-(2-amino-1-methylpropyl) is 1521237-93-3. |
| Q: What is the Chinese name of 1521237-93-3? |
| A: Chinese name of 1521237-93-3 is 1521237-93-3. |
| Q: What is the InChIKey of 1,2,4-Triazolo[4,3-b]pyridazin-3(2H)-one, 6-(2-amino-1-methylpropyl)? |
| A: InChIKey of 1,2,4-Triazolo[4,3-b]pyridazin-3(2H)-one, 6-(2-amino-1-methylpropyl) is OCDJXJKVXZUELG-UHFFFAOYSA-N. |
| Q: What is the SMILES notation of 1,2,4-Triazolo[4,3-b]pyridazin-3(2H)-one, 6-(2-amino-1-methylpropyl)? |
| A: SMILES notation of 1,2,4-Triazolo[4,3-b]pyridazin-3(2H)-one, 6-(2-amino-1-methylpropyl) is CC(N)C(C)c1ccc2n[nH]c(=O)n2n1. |
| Q: What is the English name of 1,2,4-Triazolo[4,3-b]pyridazin-3(2H)-one, 6-(2-amino-1-methylpropyl)? |
| A: The English name of 1,2,4-Triazolo[4,3-b]pyridazin-3(2H)-one, 6-(2-amino-1-methylpropyl) is 1,2,4-Triazolo[4,3-b]pyridazin-3(2H)-one, 6-(2-amino-1-methylpropyl). |