Benzene,1,1'-[(2-methylene-1,3-propanediyl)bis(oxy)]bis[4-chloro- (9CI) structure
|
Common Name | Benzene,1,1'-[(2-methylene-1,3-propanediyl)bis(oxy)]bis[4-chloro- (9CI) | ||
|---|---|---|---|---|
| CAS Number | 1522-96-9 | Molecular Weight | 309.18700 | |
| Density | 1.236g/cm3 | Boiling Point | 427.4ºC at 760mmHg | |
| Molecular Formula | C16H14Cl2O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 152.2ºC | |
| Name | 1-chloro-4-[2-[(4-chlorophenoxy)methyl]prop-2-enoxy]benzene |
|---|
| Density | 1.236g/cm3 |
|---|---|
| Boiling Point | 427.4ºC at 760mmHg |
| Molecular Formula | C16H14Cl2O2 |
| Molecular Weight | 309.18700 |
| Flash Point | 152.2ºC |
| Exact Mass | 308.03700 |
| PSA | 18.46000 |
| LogP | 5.00740 |
| Vapour Pressure | 4.08E-07mmHg at 25°C |
| Index of Refraction | 1.573 |
| InChIKey | FKBAHOXKOIXYHR-UHFFFAOYSA-N |
| SMILES | C=C(COc1ccc(Cl)cc1)COc1ccc(Cl)cc1 |
|
~88%
Benzene,1,1'-[(... CAS#:1522-96-9 |
| Literature: Levashova, V. I.; Krasnov, V. A.; Bunina-Krivorukova, L. I. Journal of Organic Chemistry USSR (English Translation), 1989 , vol. 25, # 7.2 p. 1319 - 1321 Zhurnal Organicheskoi Khimii, 1989 , vol. 25, # 7 p. 1463 - 1465 |
|
~%
Benzene,1,1'-[(... CAS#:1522-96-9 |
| Literature: Riemschneider,R. et al. Monatshefte fuer Chemie, 1965 , vol. 96, p. 147 - 158 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |