4,4,4-trifluoro-3-hydroxy-1-phenylbutane-1-one structure
|
Common Name | 4,4,4-trifluoro-3-hydroxy-1-phenylbutane-1-one | ||
|---|---|---|---|---|
| CAS Number | 1524-15-8 | Molecular Weight | 218.17200 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C10H9F3O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 4,4,4-trifluoro-3-hydroxy-1-phenylbutane-1-one |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C10H9F3O2 |
|---|---|
| Molecular Weight | 218.17200 |
| Exact Mass | 218.05500 |
| PSA | 37.30000 |
| LogP | 2.18260 |
| InChIKey | LGRAOIBBJUNFDG-UHFFFAOYSA-N |
| SMILES | O=C(CC(O)C(F)(F)F)c1ccccc1 |
| HS Code | 2914700090 |
|---|
| HS Code | 2914700090 |
|---|---|
| Summary | HS: 2914700090 halogenated, sulphonated, nitrated or nitrosated derivatives of ketones and quinones, whether or not with other oxygen function Tax rebate rate:9.0% Supervision conditions:none VAT:17.0% MFN tariff:5.5% General tariff:30.0% |
| 3,3,3-trifluoro-2-hydroxypropyl phenyl ketone |
| hydroxy-1-phenyl-4,4,4-trifluoro-2-butanone |
| (+-)-2-hydroxy-3,3,3-trifluoropropionic acid |
| rac-3,3,3-trifluoro-2-hydroxy-propionic acid |
| 3,3,3-trifluoro-2-hydroxy-propionic acid |
| 1,1,1-trifluoro-3-benzoyl-2-propanol |
| 3,3,3-Trifluormilchsaeure |
| 4,4,4-trifluoro-3-hydroxy-1-phenyl-1-butanone |
| TF-LA |
| 2-hydroxy-3,3,3-trifluoropropanoic acid |
| (DL)-3,3,3-TRIFLUOROLACTIC ACID |
| trifluorolactic acid |
| 3,3,3-TRIFLUOROLACTIC ACID |
| 4,4,4-trifluoro-3-hydroxy-1-phenylbutan-1-one |