1-Methylethyl 3-hydroxythieno[2,3-b]pyridine-2-carboxylate
Modify Date: 2025-09-13 15:43:23
![1-Methylethyl 3-hydroxythieno[2,3-b]pyridine-2-carboxylate Structure](https://www.chemsrc.com/extcaspic/222/152523-79-0.png)
1-Methylethyl 3-hydroxythieno[2,3-b]pyridine-2-carboxylate structure
|
Common Name | 1-Methylethyl 3-hydroxythieno[2,3-b]pyridine-2-carboxylate | ||
|---|---|---|---|---|
| CAS Number | 152523-79-0 | Molecular Weight | 237.28 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C11H11NO3S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 1-Methylethyl 3-hydroxythieno[2,3-b]pyridine-2-carboxylate |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C11H11NO3S |
|---|---|
| Molecular Weight | 237.28 |
| InChIKey | UJYYQKZFAOPGCI-UHFFFAOYSA-N |
| SMILES | CC(C)OC(=O)c1sc2ncccc2c1O |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the InChIKey of 1-Methylethyl 3-hydroxythieno[2,3-b]pyridine-2-carboxylate? |
| A: InChIKey of 1-Methylethyl 3-hydroxythieno[2,3-b]pyridine-2-carboxylate is UJYYQKZFAOPGCI-UHFFFAOYSA-N. |
| Q: What is the molecular weight of 1-Methylethyl 3-hydroxythieno[2,3-b]pyridine-2-carboxylate? |
| A: Molecular weight of 1-Methylethyl 3-hydroxythieno[2,3-b]pyridine-2-carboxylate is 237.28. |
| Q: What is the CAS number of 1-Methylethyl 3-hydroxythieno[2,3-b]pyridine-2-carboxylate? |
| A: CAS number of 1-Methylethyl 3-hydroxythieno[2,3-b]pyridine-2-carboxylate is 152523-79-0. |
| Q: What is the molecular formula of 1-Methylethyl 3-hydroxythieno[2,3-b]pyridine-2-carboxylate? |
| A: Molecular formula of 1-Methylethyl 3-hydroxythieno[2,3-b]pyridine-2-carboxylate is C11H11NO3S. |
| Q: What is the SMILES notation of 1-Methylethyl 3-hydroxythieno[2,3-b]pyridine-2-carboxylate? |
| A: SMILES notation of 1-Methylethyl 3-hydroxythieno[2,3-b]pyridine-2-carboxylate is CC(C)OC(=O)c1sc2ncccc2c1O. |
| Q: What is the Chinese name of 152523-79-0? |
| A: Chinese name of 152523-79-0 is 152523-79-0. |
| Q: What is the English name of 1-Methylethyl 3-hydroxythieno[2,3-b]pyridine-2-carboxylate? |
| A: The English name of 1-Methylethyl 3-hydroxythieno[2,3-b]pyridine-2-carboxylate is 1-Methylethyl 3-hydroxythieno[2,3-b]pyridine-2-carboxylate. |