methyl 2-formyl-5-methoxy-1-methylindole-3-carboxylate structure
|
Common Name | methyl 2-formyl-5-methoxy-1-methylindole-3-carboxylate | ||
|---|---|---|---|---|
| CAS Number | 152593-20-9 | Molecular Weight | 247.24700 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C13H13NO4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | methyl 2-formyl-5-methoxy-1-methylindole-3-carboxylate |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C13H13NO4 |
|---|---|
| Molecular Weight | 247.24700 |
| Exact Mass | 247.08400 |
| PSA | 57.53000 |
| LogP | 1.78600 |
| InChIKey | CFOVRWSOOZYHNB-UHFFFAOYSA-N |
| SMILES | COC(=O)c1c(C=O)n(C)c2ccc(OC)cc12 |
| HS Code | 2933990090 |
|---|
|
~88%
methyl 2-formyl... CAS#:152593-20-9 |
| Literature: Kinugawa, Masahiko; Arai, Hitoshi; Nishikawa, Hiroshi; Sakaguchi, Akihiko; Ogasa, Takehiro; et al. Journal of the Chemical Society, Perkin Transactions 1: Organic and Bio-Organic Chemistry (1972-1999), 1995 , # 21 p. 2677 - 2678 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |
| HS Code | 2933990090 |
|---|---|
| Summary | 2933990090. heterocyclic compounds with nitrogen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| Methyl 2-formyl-5-methoxy-1-methyl-1H-indole-3-carboxylate |
| 2-formyl-5-methoxy-3-methoxycarbonyl-1-methylindole |