qianhucoumarin B structure
|
Common Name | qianhucoumarin B | ||
|---|---|---|---|---|
| CAS Number | 152615-14-0 | Molecular Weight | 304.29 | |
| Density | 1.38g/cm3 | Boiling Point | 438.5ºC at 760mmHg | |
| Molecular Formula | C16H16O6 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 160.7ºC | |
Use of qianhucoumarin BQianhucoumarin B is a coumarin derivative. Qianhucoumarin B can be isolated from from the traditional Chinese medicine Qianhu, roots of Peucedanum praeruptorum[1]. |
| Name | [(9S,10S)-10-hydroxy-8,8-dimethyl-2-oxo-9,10-dihydropyrano[2,3-f]chromen-9-yl] acetate |
|---|---|
| Synonym | More Synonyms |
| Description | Qianhucoumarin B is a coumarin derivative. Qianhucoumarin B can be isolated from from the traditional Chinese medicine Qianhu, roots of Peucedanum praeruptorum[1]. |
|---|---|
| Related Catalog | |
| References |
| Density | 1.38g/cm3 |
|---|---|
| Boiling Point | 438.5ºC at 760mmHg |
| Molecular Formula | C16H16O6 |
| Molecular Weight | 304.29 |
| Flash Point | 160.7ºC |
| Exact Mass | 304.09500 |
| PSA | 85.97000 |
| LogP | 1.92910 |
| Vapour Pressure | 1.82E-08mmHg at 25°C |
| Index of Refraction | 1.605 |
| InChIKey | WGBFEDHNTNVZGG-ZFWWWQNUSA-N |
| SMILES | CC(=O)OC1C(O)c2c(ccc3ccc(=O)oc23)OC1(C)C |
| 2H,8H-Benzo(1,2-b:3,4-b')dipyran-2-one,9-(acetyloxy)-9,10-dihydro-10-hydroxy-8,8-dimethyl-,(9S-cis) |
| Qianhucoumarin B |