Methyl 4-methyl-2-propyl-1H-benzimidazole-6-carboxylate structure
|
Common Name | Methyl 4-methyl-2-propyl-1H-benzimidazole-6-carboxylate | ||
|---|---|---|---|---|
| CAS Number | 152628-00-7 | Molecular Weight | 232.27800 | |
| Density | 1.17g/cm3 | Boiling Point | 434.22ºC at 760 mmHg | |
| Molecular Formula | C13H16N2O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | Methyl 7-methyl-2-propyl-1H-benzo[d]imidazole-5-carboxylate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.17g/cm3 |
|---|---|
| Boiling Point | 434.22ºC at 760 mmHg |
| Molecular Formula | C13H16N2O2 |
| Molecular Weight | 232.27800 |
| Exact Mass | 232.12100 |
| PSA | 54.98000 |
| LogP | 2.61040 |
| Vapour Pressure | 0mmHg at 25°C |
| Index of Refraction | 1.594 |
| InChIKey | DEFDQXCQBZEOGY-UHFFFAOYSA-N |
| SMILES | CCCc1nc2c(C)cc(C(=O)OC)cc2[nH]1 |
| HS Code | 2933990090 |
|---|
| Precursor 9 | |
|---|---|
| DownStream 6 | |
| HS Code | 2933990090 |
|---|---|
| Summary | 2933990090. heterocyclic compounds with nitrogen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 7-methyl-2-propyl-1h-benzoimidazole-5-carboxylic acid methyl ester |