Palitantin structure
|
Common Name | Palitantin | ||
|---|---|---|---|---|
| CAS Number | 15265-28-8 | Molecular Weight | 254.32200 | |
| Density | 1.205g/cm3 | Boiling Point | 429.1ºC at 760mmHg | |
| Molecular Formula | C14H22O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 227.4ºC | |
Use of PalitantinPalitantin ((±)-Palitantin), a metabolite of Penicillium frequentans on Leishmania brasiliensis, has antiprotozoal effect against Leishmania brasiliensis[1]. |
| Name | (2R,3R,5S,6R)-5-[(1E,3E)-hepta-1,3-dienyl]-2,3-dihydroxy-6-(hydroxymethyl)cyclohexan-1-one |
|---|---|
| Synonym | More Synonyms |
| Description | Palitantin ((±)-Palitantin), a metabolite of Penicillium frequentans on Leishmania brasiliensis, has antiprotozoal effect against Leishmania brasiliensis[1]. |
|---|---|
| Related Catalog | |
| References |
| Density | 1.205g/cm3 |
|---|---|
| Boiling Point | 429.1ºC at 760mmHg |
| Molecular Formula | C14H22O4 |
| Molecular Weight | 254.32200 |
| Flash Point | 227.4ºC |
| Exact Mass | 254.15200 |
| PSA | 77.76000 |
| LogP | 0.81820 |
| Vapour Pressure | 3.67E-09mmHg at 25°C |
| Index of Refraction | 1.593 |
| InChIKey | MPOXQBRZHHNMER-XZQMCIKJSA-N |
| SMILES | CCCC=CC=CC1CC(O)C(O)C(=O)C1CO |
| Palitantin |
| UNII-05D54KLN3M |