Pentanoic acid,3-methyl-4-nitro-2-(triphenylphosphoranylidene)-, methyl ester structure
|
Common Name | Pentanoic acid,3-methyl-4-nitro-2-(triphenylphosphoranylidene)-, methyl ester | ||
|---|---|---|---|---|
| CAS Number | 15267-30-8 | Molecular Weight | 435.45200 | |
| Density | 1.2g/cm3 | Boiling Point | 576.5ºC at 760mmHg | |
| Molecular Formula | C25H26NO4P | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 302.5ºC | |
| Name | 4-nitro-3-methyl-2-butenol |
|---|---|
| Synonym | More Synonyms |
| Density | 1.2g/cm3 |
|---|---|
| Boiling Point | 576.5ºC at 760mmHg |
| Molecular Formula | C25H26NO4P |
| Molecular Weight | 435.45200 |
| Flash Point | 302.5ºC |
| Exact Mass | 435.16000 |
| PSA | 81.93000 |
| LogP | 4.15040 |
| Vapour Pressure | 2.72E-13mmHg at 25°C |
| Index of Refraction | 1.593 |
| InChIKey | AGXZKQDOMNQNTO-UHFFFAOYSA-N |
| SMILES | COC(=O)C(C(C)C(C)[N+](=O)[O-])=P(c1ccccc1)(c1ccccc1)c1ccccc1 |
|
~%
Pentanoic acid,... CAS#:15267-30-8 |
| Literature: Asunskis,J.; Shechter,H. Journal of Organic Chemistry, 1968 , vol. 33, # 3 p. 1164 - 1168 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |
| 4-Nitro-3-methyl-2-triphenylphosphoranylidenvaleriansaeuremethylester |
| 2-Buten-1-ol,3-methyl-4-nitro |