α-Methyl-N-(2-methyl-2-propenyl)-m-(trifluoromethyl)benzeneethanamine structure
|
Common Name | α-Methyl-N-(2-methyl-2-propenyl)-m-(trifluoromethyl)benzeneethanamine | ||
|---|---|---|---|---|
| CAS Number | 15270-47-0 | Molecular Weight | 257.29500 | |
| Density | 1.061g/cm3 | Boiling Point | 283.6ºC at 760 mmHg | |
| Molecular Formula | C14H18F3N | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 125.3ºC | |
| Name | 2-methyl-N-[1-[3-(trifluoromethyl)phenyl]propan-2-yl]prop-2-en-1-amine |
|---|---|
| Synonym | More Synonyms |
| Density | 1.061g/cm3 |
|---|---|
| Boiling Point | 283.6ºC at 760 mmHg |
| Molecular Formula | C14H18F3N |
| Molecular Weight | 257.29500 |
| Flash Point | 125.3ºC |
| Exact Mass | 257.13900 |
| PSA | 12.03000 |
| LogP | 4.19300 |
| Vapour Pressure | 0.00313mmHg at 25°C |
| Index of Refraction | 1.465 |
| InChIKey | LBYGOKYMYRLVAO-UHFFFAOYSA-N |
| SMILES | C=C(C)CNC(C)Cc1cccc(C(F)(F)F)c1 |
| HS Code | 2921499090 |
|---|
| HS Code | 2921499090 |
|---|---|
| Summary | 2921499090 other aromatic monoamines and their derivatives; salts thereof VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:30.0% |
| 2-methyl-N-{1-[3-(trifluoromethyl)phenyl]propan-2-yl}prop-2-en-1-amine |