Valsartan Impurity 32 structure
|
Common Name | Valsartan Impurity 32 | ||
|---|---|---|---|---|
| CAS Number | 152708-24-2 | Molecular Weight | 277.28 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C14H11N7 | Melting Point | 40 - 43°C | |
| MSDS | N/A | Flash Point | N/A | |
| Name | Valsartan Impurity 32 |
|---|
| Melting Point | 40 - 43°C |
|---|---|
| Molecular Formula | C14H11N7 |
| Molecular Weight | 277.28 |
| Appearance of Characters | Solid | White to Pale Brown Low-Melting |
| InChIKey | HIWODOJPZXUTRT-UHFFFAOYSA-N |
| SMILES | [N-]=[N+]=NCc1ccc(-c2ccccc2-c2nn[nH]n2)cc1 |
| Storage condition | Amber Vial, Refrigerator, Under inert atmosphere |
| Stability | Light Sensitive |
| Water Solubility | Chloroform (Slightly), Methanol (Slightly) |