triheptyl benzene-1,2,4-tricarboxylate structure
|
Common Name | triheptyl benzene-1,2,4-tricarboxylate | ||
|---|---|---|---|---|
| CAS Number | 1528-48-9 | Molecular Weight | 504.69900 | |
| Density | 1.008g/cm3 | Boiling Point | 561.3ºC at 760mmHg | |
| Molecular Formula | C30H48O6 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 231.7ºC | |
| Name | triheptyl benzene-1,2,4-tricarboxylate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.008g/cm3 |
|---|---|
| Boiling Point | 561.3ºC at 760mmHg |
| Molecular Formula | C30H48O6 |
| Molecular Weight | 504.69900 |
| Flash Point | 231.7ºC |
| Exact Mass | 504.34500 |
| PSA | 78.90000 |
| LogP | 8.06820 |
| Vapour Pressure | 1.25E-12mmHg at 25°C |
| Index of Refraction | 1.491 |
| InChIKey | SYKYENWAGZGAFV-UHFFFAOYSA-N |
| SMILES | CCCCCCCOC(=O)c1ccc(C(=O)OCCCCCCC)c(C(=O)OCCCCCCC)c1 |
| HS Code | 2917399090 |
|---|
| HS Code | 2917399090 |
|---|---|
| Summary | 2917399090 aromatic polycarboxylic acids, their anhydrides, halides, peroxides, peroxyacids and their derivatives。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:6.5%。General tariff:30.0% |
| EINECS 216-207-6 |
| 1,2,4-Benzenetricarboxylicacid,1,2,4-triheptyl ester |
| Trimellitsaeure-triheptylester |