2,4,5-tribromoimidazole-1-n-butylcarboxylate structure
|
Common Name | 2,4,5-tribromoimidazole-1-n-butylcarboxylate | ||
|---|---|---|---|---|
| CAS Number | 15287-51-1 | Molecular Weight | 404.88100 | |
| Density | 2.14g/cm3 | Boiling Point | 427.4ºC at 760mmHg | |
| Molecular Formula | C8H9Br3N2O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 212.3ºC | |
| Name | butyl 2,4,5-tribromoimidazole-1-carboxylate |
|---|---|
| Synonym | More Synonyms |
| Density | 2.14g/cm3 |
|---|---|
| Boiling Point | 427.4ºC at 760mmHg |
| Molecular Formula | C8H9Br3N2O2 |
| Molecular Weight | 404.88100 |
| Flash Point | 212.3ºC |
| Exact Mass | 401.82100 |
| PSA | 44.12000 |
| LogP | 3.95540 |
| Vapour Pressure | 1.65E-07mmHg at 25°C |
| Index of Refraction | 1.645 |
| InChIKey | UXSDUYGMRLQRMS-UHFFFAOYSA-N |
| SMILES | CCCCOC(=O)n1c(Br)nc(Br)c1Br |
| HS Code | 2933290090 |
|---|
| HS Code | 2933290090 |
|---|---|
| Summary | 2933290090. other compounds containing an unfused imidazole ring (whether or not hydrogenated) in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 1-n-Butylcarboxylate-2,4,5-tribromoimidazole |
| 2,4,5-tribromo-imidazole-1-carboxylic acid butyl ester |
| 1-Imidazolecarboxylic acid,2,4,5-tribromo-,butyl ester |
| 2,4,5-Tribromoimidazole-1-n-butylcarboxylate |
| 2,4,5-Tribromo-1-imidazolecarboxylic acid butyl ester |