2,2',2''-[benzene-1,2,3-triyltri(oxy)]tris[N,N-diethylethylamine] structure
|
Common Name | 2,2',2''-[benzene-1,2,3-triyltri(oxy)]tris[N,N-diethylethylamine] | ||
|---|---|---|---|---|
| CAS Number | 153-76-4 | Molecular Weight | 891.52900 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C30H60I3N3O3 | Melting Point | 147.5ºC | |
| MSDS | N/A | Flash Point | N/A | |
| Name | gallamine |
|---|---|
| Synonym | More Synonyms |
| Melting Point | 147.5ºC |
|---|---|
| Molecular Formula | C30H60I3N3O3 |
| Molecular Weight | 891.52900 |
| Exact Mass | 891.17700 |
| PSA | 27.69000 |
| InChIKey | ICLWTJIMXVISSR-UHFFFAOYSA-N |
| SMILES | CCN(CC)CCOc1cccc(OCCN(CC)CC)c1OCCN(CC)CC |
| HS Code | 2922199090 |
|---|
|
~%
2,2',2''-[benze... CAS#:153-76-4 |
| Literature: Protiva et al. Collection of Czechoslovak Chemical Communications, 1948 , vol. 13, p. 326,332 |
| HS Code | 2922199090 |
|---|---|
| Summary | 2922199090. other amino-alcohols, other than those containing more than one kind of oxygen function, their ethers and esters; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| 2-(2,6-bis(2-(diethylamino)ethoxy)phenoxy)-N,N-diethylethanamine |
| Tris-O-(2-diaethylamino-aethyl)-pyrogallol |
| EINECS 205-816-2 |
| 2-[2,3-bis[2-(diethylamino)ethoxy]phenoxy]-N,N-diethylethanamine |
| 1,2,3-tris-(2-diethylamino-ethoxy)-benzene |
| 2,2',2''-[benzene-1,2,3-triyltri(oxy)]tris[N,N-diethylethylamine] |
| Gallamonum |
| 1,2,3-Tris-(2-diaethylamino-aethoxy)-benzol |
| Gallamine [BAN] |
| Gallamine Triethiiodide |