benzhydryl triphenylphosphonium chloride structure
|
Common Name | benzhydryl triphenylphosphonium chloride | ||
|---|---|---|---|---|
| CAS Number | 1530-43-4 | Molecular Weight | 464.96500 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C31H26ClP | Melting Point | 266-270ºC | |
| MSDS | N/A | Flash Point | N/A | |
| Name | benzhydryl(triphenyl)phosphanium,chloride |
|---|---|
| Synonym | More Synonyms |
| Melting Point | 266-270ºC |
|---|---|
| Molecular Formula | C31H26ClP |
| Molecular Weight | 464.96500 |
| Exact Mass | 464.14600 |
| PSA | 13.59000 |
| LogP | 3.77410 |
| InChIKey | PKMDZVYQEANDCP-UHFFFAOYSA-M |
| SMILES | [Cl-].c1ccc(C(c2ccccc2)[P+](c2ccccc2)(c2ccccc2)c2ccccc2)cc1 |
|
~57%
benzhydryl trip... CAS#:1530-43-4 |
| Literature: Ammer, Johannes; Nolte, Christoph; Karaghiosoff, Konstantin; Thallmair, Sebastian; Mayer, Peter; Devivie-Riedle, Regina; Mayr, Herbert Chemistry - A European Journal, 2013 , vol. 19, # 43 p. 14612 - 14630 |
|
~%
benzhydryl trip... CAS#:1530-43-4 |
| Literature: Staudinger; Meyer,J. Helvetica Chimica Acta, 1919 , vol. 2, p. 644 |
|
~%
benzhydryl trip... CAS#:1530-43-4 |
| Literature: Wittig,G.; Schlosser,M. Tetrahedron, 1962 , vol. 18, p. 1023 - 1028 |
|
~%
benzhydryl trip... CAS#:1530-43-4 |
| Literature: Staudinger; Meyer,J. Helvetica Chimica Acta, 1919 , vol. 2, p. 644 |
|
~%
benzhydryl trip... CAS#:1530-43-4 |
| Literature: Staudinger; Meyer,J. Helvetica Chimica Acta, 1919 , vol. 2, p. 644 |
| HS Code | 2931900090 |
|---|---|
| Summary | 2931900090. other organo-inorganic compounds. VAT:17.0%. Tax rebate rate:13.0%. Supervision conditions:AB(certificate of inspection for goods inward,certificate of inspection for goods outward). MFN tariff:6.5%. General tariff:30.0% |
| Benzhydryl-triphenyl-phosphonium |
| EINECS 216-229-6 |
| MFCD00051891 |
| benzhydryl-triphenyl-phosphonium,chloride |
| benzhydryl(triphenyl)phosphanium chloride |
| (Diphenylmethyl)triphenylphosphonium chloride |
| Diphenylmethyl-triphenyl-phosphonium |
| Benzhydryl-triphenyl-phosphonium,Chlorid |
| BENZHYDRYL TRIPHENYLPHOSPHONIUM CHLORIDE |