ethyl 3-(1-phenylethyl)imidazole-4-carboxylate structure
|
Common Name | ethyl 3-(1-phenylethyl)imidazole-4-carboxylate | ||
|---|---|---|---|---|
| CAS Number | 15301-65-2 | Molecular Weight | 244.28900 | |
| Density | 1.11g/cm3 | Boiling Point | 391.5ºC at 760mmHg | |
| Molecular Formula | C14H16N2O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 190.6ºC | |
| Name | ethyl 3-(1-phenylethyl)imidazole-4-carboxylate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.11g/cm3 |
|---|---|
| Boiling Point | 391.5ºC at 760mmHg |
| Molecular Formula | C14H16N2O2 |
| Molecular Weight | 244.28900 |
| Flash Point | 190.6ºC |
| Exact Mass | 244.12100 |
| PSA | 44.12000 |
| LogP | 2.66910 |
| Vapour Pressure | 2.46E-06mmHg at 25°C |
| Index of Refraction | 1.561 |
| InChIKey | NPUKDXXFDDZOKR-UHFFFAOYSA-N |
| SMILES | CCOC(=O)c1cncn1C(C)c1ccccc1 |
| HS Code | 2933290090 |
|---|
| HS Code | 2933290090 |
|---|---|
| Summary | 2933290090. other compounds containing an unfused imidazole ring (whether or not hydrogenated) in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| Amidate |
| Absele |
| salt of etomidate |
| Etomidic acid |
| Ethnor |
| ethyl 1-(1-phenylethyl)-1 H-imidazole-5-carboxylate |
| D-Etomidate |
| Radenarcon |
| 3-(1-phenyl-ethyl)-3H-imidazole-4-carboxylic acid ethyl ester |
| Ethomidate |
| Radenarkon |
| R-(+)-ethyl 1-(1-phenylethyl)-1H-imidazole-5-carboxylate |
| Hypnomidate |