6-CHLORO-2-PIPERAZINO-1,3-BENZOTHIAZOLE structure
|
Common Name | 6-CHLORO-2-PIPERAZINO-1,3-BENZOTHIAZOLE | ||
|---|---|---|---|---|
| CAS Number | 153025-29-7 | Molecular Weight | 253.75100 | |
| Density | 1.36g/cm3 | Boiling Point | 402.1ºC at 760 mmHg | |
| Molecular Formula | C11H12ClN3S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 197ºC | |
| Name | 6-chloro-2-piperazin-1-yl-1,3-benzothiazole |
|---|---|
| Synonym | More Synonyms |
| Density | 1.36g/cm3 |
|---|---|
| Boiling Point | 402.1ºC at 760 mmHg |
| Molecular Formula | C11H12ClN3S |
| Molecular Weight | 253.75100 |
| Flash Point | 197ºC |
| Exact Mass | 253.04400 |
| PSA | 56.40000 |
| LogP | 2.75310 |
| Vapour Pressure | 1.12E-06mmHg at 25°C |
| Index of Refraction | 1.662 |
| InChIKey | HKQTVOYPBKNRJL-UHFFFAOYSA-N |
| SMILES | Clc1ccc2nc(N3CCNCC3)sc2c1 |
| HS Code | 2934200090 |
|---|
|
~%
6-CHLORO-2-PIPE... CAS#:153025-29-7 |
| Literature: Breitenbucher, J. Guy; Cai, Hui; Edwards, James P.; Grice, Cheryl A.; Gu, Yin; Gustin, Darin J.; Karlsson, Lars; Khatuya, Haripada; Meduna, Steven P.; Pio, Barbara A.; Sun, Siquan; Tays, Kevin L.; Thumond, Robin L.; Wei, Jianmei Patent: US2003/73672 A1, 2003 ; |
|
~%
6-CHLORO-2-PIPE... CAS#:153025-29-7 |
| Literature: Verma, Sanjeev K.; Acharya; Kaushik Organic and Biomolecular Chemistry, 2011 , vol. 9, # 5 p. 1324 - 1327 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| HS Code | 2934200090 |
|---|---|
| Summary | 2934200090. other compounds containing in the structure a benzothiazole ring-system (whether or not hydrogenated), not further fused. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 6-chloro-2-piperazin-1-yl-benzothiazole |
| F2146-0078 |
| HMS566G20 |