4-Boc-amino-2,2-dimethylbutyric acid structure
|
Common Name | 4-Boc-amino-2,2-dimethylbutyric acid | ||
|---|---|---|---|---|
| CAS Number | 153039-17-9 | Molecular Weight | 231.28900 | |
| Density | 1.065g/cm3 | Boiling Point | 369.9ºC at 760mmHg | |
| Molecular Formula | C11H21NO4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 177.5ºC | |
Use of 4-Boc-amino-2,2-dimethylbutyric acid4-Boc-amino-22-dimethylbutyric acid is an alkyl/ether-based PROTAC linker that can be used in the synthesis of PROTACs[1]. |
| Name | 4-boc-amino-2,2-dimethylbutyric acid |
|---|---|
| Synonym | More Synonyms |
| Description | 4-Boc-amino-22-dimethylbutyric acid is an alkyl/ether-based PROTAC linker that can be used in the synthesis of PROTACs[1]. |
|---|---|
| Related Catalog | |
| Target |
Alkyl/ether |
| In Vitro | PROTACs contain two different ligands connected by a linker; one is a ligand for an E3 ubiquitin ligase and the other is for the target protein. PROTACs exploit the intracellular ubiquitin-proteasome system to selectively degrade target proteins[1]. |
| References |
| Density | 1.065g/cm3 |
|---|---|
| Boiling Point | 369.9ºC at 760mmHg |
| Molecular Formula | C11H21NO4 |
| Molecular Weight | 231.28900 |
| Flash Point | 177.5ºC |
| Exact Mass | 231.14700 |
| PSA | 75.63000 |
| LogP | 2.40290 |
| Vapour Pressure | 1.74E-06mmHg at 25°C |
| Index of Refraction | 1.463 |
| InChIKey | TWMVVJUXUMIAAJ-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)NCCC(C)(C)C(=O)O |
| 1-Boc-3-Carbamoylpiperazine |