Benzenesulfonamide,N-(4,5-dichloro-2-nitrophenyl)-4-nitro- structure
|
Common Name | Benzenesulfonamide,N-(4,5-dichloro-2-nitrophenyl)-4-nitro- | ||
|---|---|---|---|---|
| CAS Number | 15312-13-7 | Molecular Weight | 392.17100 | |
| Density | 1.734g/cm3 | Boiling Point | 555ºC at 760mmHg | |
| Molecular Formula | C12H7Cl2N3O6S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 289.5ºC | |
| Name | N-(4,5-dichloro-2-nitrophenyl)-4-nitrobenzenesulfonamide |
|---|---|
| Synonym | More Synonyms |
| Density | 1.734g/cm3 |
|---|---|
| Boiling Point | 555ºC at 760mmHg |
| Molecular Formula | C12H7Cl2N3O6S |
| Molecular Weight | 392.17100 |
| Flash Point | 289.5ºC |
| Exact Mass | 390.94300 |
| PSA | 146.19000 |
| LogP | 5.81080 |
| Vapour Pressure | 2.33E-12mmHg at 25°C |
| Index of Refraction | 1.681 |
| InChIKey | ALNWLDQCPWGSKT-UHFFFAOYSA-N |
| SMILES | O=[N+]([O-])c1ccc(S(=O)(=O)Nc2cc(Cl)c(Cl)cc2[N+](=O)[O-])cc1 |
|
~%
Benzenesulfonam... CAS#:15312-13-7 |
| Literature: Woolley Journal of the American Chemical Society, 1952 , vol. 74, p. 5450,5451 |
|
~%
Benzenesulfonam... CAS#:15312-13-7 |
| Literature: Woolley Journal of the American Chemical Society, 1952 , vol. 74, p. 5450,5451 |
|
~%
Benzenesulfonam... CAS#:15312-13-7 |
| Literature: Woolley Journal of the American Chemical Society, 1952 , vol. 74, p. 5450,5451 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |
| 4-nitro-benzenesulfonic acid-(4,5-dichloro-2-nitro-anilide) |
| 4-Nitro-benzolsulfonsaeure-(4,5-dichlor-2-nitro-anilid) |