RO 23-9358 structure
|
Common Name | RO 23-9358 | ||
|---|---|---|---|---|
| CAS Number | 153125-17-8 | Molecular Weight | 521.72900 | |
| Density | 1.054g/cm3 | Boiling Point | 656.7ºC at 760mmHg | |
| Molecular Formula | C30H51NO6 | Melting Point | N/A | |
| MSDS | Chinese USA | Flash Point | 351ºC | |
| Name | 2-[N-(carboxymethyl)-3,5-didecoxyanilino]acetic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.054g/cm3 |
|---|---|
| Boiling Point | 656.7ºC at 760mmHg |
| Molecular Formula | C30H51NO6 |
| Molecular Weight | 521.72900 |
| Flash Point | 351ºC |
| Exact Mass | 521.37200 |
| PSA | 96.30000 |
| LogP | 7.70120 |
| Vapour Pressure | 3.85E-18mmHg at 25°C |
| Index of Refraction | 1.517 |
| InChIKey | SWOCSPJYINCHOW-UHFFFAOYSA-N |
| SMILES | CCCCCCCCCCOc1cc(OCCCCCCCCCC)cc(N(CC(=O)O)CC(=O)O)c1 |
| Personal Protective Equipment | Eyeshields;Gloves;type N95 (US);type P1 (EN143) respirator filter |
|---|---|
| RIDADR | NONH for all modes of transport |
|
~76%
RO 23-9358 CAS#:153125-17-8 |
| Literature: Hoffmann-La Roche Inc. Patent: US5324747 A1, 1994 ; US 5324747 A |
| Ro 23-9358 |
| N-[3,5-Bis(decyloxy)phenyl]-N-(carboxymethyl)glycine |