Acetic acid,2-[(2,4-dichlorophenyl)amino]-2-oxo-, ethyl ester structure
|
Common Name | Acetic acid,2-[(2,4-dichlorophenyl)amino]-2-oxo-, ethyl ester | ||
|---|---|---|---|---|
| CAS Number | 15313-47-0 | Molecular Weight | 262.08900 | |
| Density | 1.432g/cm3 | Boiling Point | N/A | |
| Molecular Formula | C10H9Cl2NO3 | Melting Point | 116-118ºC | |
| MSDS | N/A | Flash Point | N/A | |
| Name | ethyl 2-(2,4-dichloroanilino)-2-oxoacetate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.432g/cm3 |
|---|---|
| Melting Point | 116-118ºC |
| Molecular Formula | C10H9Cl2NO3 |
| Molecular Weight | 262.08900 |
| Exact Mass | 260.99600 |
| PSA | 55.40000 |
| LogP | 2.56800 |
| Index of Refraction | 1.585 |
| InChIKey | BRUUNEWBCZFVMW-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C(=O)Nc1ccc(Cl)cc1Cl |
| HS Code | 2924299090 |
|---|
| HS Code | 2924299090 |
|---|---|
| Summary | 2924299090. other cyclic amides (including cyclic carbamates) and their derivatives; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| N-2',4'-Dichlorphenyl-oxamidsaeure-ethylester |