Benzamide, 3,4-dichloro-N-(2-chloroethyl)- structure
|
Common Name | Benzamide, 3,4-dichloro-N-(2-chloroethyl)- | ||
|---|---|---|---|---|
| CAS Number | 15317-17-6 | Molecular Weight | 252.52500 | |
| Density | 1.39g/cm3 | Boiling Point | 362.7ºC at 760 mmHg | |
| Molecular Formula | C9H8Cl3NO | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 173.2ºC | |
| Name | 3,4-dichloro-N-(2-chloroethyl)benzamide |
|---|
| Density | 1.39g/cm3 |
|---|---|
| Boiling Point | 362.7ºC at 760 mmHg |
| Molecular Formula | C9H8Cl3NO |
| Molecular Weight | 252.52500 |
| Flash Point | 173.2ºC |
| Exact Mass | 250.96700 |
| PSA | 29.10000 |
| LogP | 3.35290 |
| Vapour Pressure | 1.89E-05mmHg at 25°C |
| Index of Refraction | 1.565 |
| InChIKey | WRZHORZVAHONJR-UHFFFAOYSA-N |
| SMILES | O=C(NCCCl)c1ccc(Cl)c(Cl)c1 |
| HS Code | 2924299090 |
|---|
|
~%
Benzamide, 3,4-... CAS#:15317-17-6 |
| Literature: Pridgen, Lendon N. Journal of Organic Chemistry, 1982 , vol. 47, # 22 p. 4319 - 4323 |
|
~%
Benzamide, 3,4-... CAS#:15317-17-6 |
| Literature: Pridgen, Lendon N. Journal of Organic Chemistry, 1982 , vol. 47, # 22 p. 4319 - 4323 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| HS Code | 2924299090 |
|---|---|
| Summary | 2924299090. other cyclic amides (including cyclic carbamates) and their derivatives; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |