1-((4-Hydrazinylphenyl)sulfonyl)-3,3-dimethylpyrrolidine
Modify Date: 2025-08-27 21:13:23
1-((4-Hydrazinylphenyl)sulfonyl)-3,3-dimethylpyrrolidine structure
|
Common Name | 1-((4-Hydrazinylphenyl)sulfonyl)-3,3-dimethylpyrrolidine | ||
|---|---|---|---|---|
| CAS Number | 1531703-28-2 | Molecular Weight | 269.37 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C12H19N3O2S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 1-((4-Hydrazinylphenyl)sulfonyl)-3,3-dimethylpyrrolidine |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C12H19N3O2S |
|---|---|
| Molecular Weight | 269.37 |
| InChIKey | TYMAWGKMCWNVRN-UHFFFAOYSA-N |
| SMILES | CC1(C)CCN(S(=O)(=O)c2ccc(NN)cc2)C1 |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the CAS number of 1-((4-Hydrazinylphenyl)sulfonyl)-3,3-dimethylpyrrolidine? |
| A: CAS number of 1-((4-Hydrazinylphenyl)sulfonyl)-3,3-dimethylpyrrolidine is 1531703-28-2. |
| Q: What is the English name of 1-((4-Hydrazinylphenyl)sulfonyl)-3,3-dimethylpyrrolidine? |
| A: The English name of 1-((4-Hydrazinylphenyl)sulfonyl)-3,3-dimethylpyrrolidine is 1-((4-Hydrazinylphenyl)sulfonyl)-3,3-dimethylpyrrolidine. |
| Q: What is the molecular weight of 1-((4-Hydrazinylphenyl)sulfonyl)-3,3-dimethylpyrrolidine? |
| A: Molecular weight of 1-((4-Hydrazinylphenyl)sulfonyl)-3,3-dimethylpyrrolidine is 269.37. |
| Q: What is the InChIKey of 1-((4-Hydrazinylphenyl)sulfonyl)-3,3-dimethylpyrrolidine? |
| A: InChIKey of 1-((4-Hydrazinylphenyl)sulfonyl)-3,3-dimethylpyrrolidine is TYMAWGKMCWNVRN-UHFFFAOYSA-N. |
| Q: What is the molecular formula of 1-((4-Hydrazinylphenyl)sulfonyl)-3,3-dimethylpyrrolidine? |
| A: Molecular formula of 1-((4-Hydrazinylphenyl)sulfonyl)-3,3-dimethylpyrrolidine is C12H19N3O2S. |
| Q: What is the Chinese name of 1531703-28-2? |
| A: Chinese name of 1531703-28-2 is 1531703-28-2. |
| Q: What is the SMILES notation of 1-((4-Hydrazinylphenyl)sulfonyl)-3,3-dimethylpyrrolidine? |
| A: SMILES notation of 1-((4-Hydrazinylphenyl)sulfonyl)-3,3-dimethylpyrrolidine is CC1(C)CCN(S(=O)(=O)c2ccc(NN)cc2)C1. |