Cyclohexanecarboxylic acid 4-piperidinocyclohexyl ester structure
|
Common Name | Cyclohexanecarboxylic acid 4-piperidinocyclohexyl ester | ||
|---|---|---|---|---|
| CAS Number | 1532-06-5 | Molecular Weight | 293.44400 | |
| Density | 1.04g/cm3 | Boiling Point | 387.6ºC at 760 mmHg | |
| Molecular Formula | C18H31NO2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 121.7ºC | |
| Name | (4-piperidin-1-ylcyclohexyl) cyclohexanecarboxylate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.04g/cm3 |
|---|---|
| Boiling Point | 387.6ºC at 760 mmHg |
| Molecular Formula | C18H31NO2 |
| Molecular Weight | 293.44400 |
| Flash Point | 121.7ºC |
| Exact Mass | 293.23500 |
| PSA | 29.54000 |
| LogP | 3.84490 |
| Vapour Pressure | 3.26E-06mmHg at 25°C |
| Index of Refraction | 1.518 |
| InChIKey | QDAFVPZEOVJIJF-UHFFFAOYSA-N |
| SMILES | O=C(OC1CCC(N2CCCCC2)CC1)C1CCCCC1 |
| HS Code | 2933399090 |
|---|
| HS Code | 2933399090 |
|---|---|
| Summary | 2933399090. other compounds containing an unfused pyridine ring (whether or not hydrogenated) in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 4-Piperidinocyclohexanol-hexahydrobenzoat |
| Cyclohexanecarboxylic acid,4-piperidinocyclohexyl ester |
| 4-Piperidinocyclohexyl ester of cyclohexanecarboxylic acid |