4-Piperidinocyclohexyl p-nitrobenzoate structure
|
Common Name | 4-Piperidinocyclohexyl p-nitrobenzoate | ||
|---|---|---|---|---|
| CAS Number | 1532-14-5 | Molecular Weight | 332.39400 | |
| Density | 1.22g/cm3 | Boiling Point | 472ºC at 760mmHg | |
| Molecular Formula | C18H24N2O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 239.2ºC | |
| Name | (4-piperidin-1-ylcyclohexyl) 4-nitrobenzoate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.22g/cm3 |
|---|---|
| Boiling Point | 472ºC at 760mmHg |
| Molecular Formula | C18H24N2O4 |
| Molecular Weight | 332.39400 |
| Flash Point | 239.2ºC |
| Exact Mass | 332.17400 |
| PSA | 75.36000 |
| LogP | 4.00980 |
| Vapour Pressure | 4.45E-09mmHg at 25°C |
| Index of Refraction | 1.577 |
| InChIKey | RPEZKQMDZRGSNQ-UHFFFAOYSA-N |
| SMILES | O=C(OC1CCC(N2CCCCC2)CC1)c1ccc([N+](=O)[O-])cc1 |
| HS Code | 2933399090 |
|---|
| HS Code | 2933399090 |
|---|---|
| Summary | 2933399090. other compounds containing an unfused pyridine ring (whether or not hydrogenated) in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 4-Piperidinocyclohexyl p-nitrobenzoate |
| Cyclohexanol,4-piperidino-,p-nitrobenzoate (ester) |