Anticancer agent 4
Modify Date: 2026-06-27 11:25:38
Anticancer agent 4 structure
|
Common Name | Anticancer agent 4 | ||
|---|---|---|---|---|
| CAS Number | 153236-38-5 | Molecular Weight | 327.4 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C18H21N3OS | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | Anticancer agent 4 |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C18H21N3OS |
|---|---|
| Molecular Weight | 327.4 |
| InChIKey | ZHLMWNKEIRSOPZ-UHFFFAOYSA-N |
| SMILES | CN(C)CCNC1=C2C(=C(C=C1)CN)SC3=CC=CC=C3C2=O |
This table contains target information, in‑vitro & in‑vivo assay data for this compound.
|
Name: Compound was tested for in vivo growth inhibition of pancreatic ductal adenocarcinoma...
Source: ChEMBL
Target: Mus musculus
External Id: CHEMBL878071
|
Total 1, Current Page 1 of 1
1
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the CAS number of Anticancer agent 4? |
| A: CAS number of Anticancer agent 4 is 153236-38-5. |
| Q: What is the molecular weight of Anticancer agent 4? |
| A: Molecular weight of Anticancer agent 4 is 327.4. |
| Q: What is the SMILES notation of Anticancer agent 4? |
| A: SMILES notation of Anticancer agent 4 is CN(C)CCNC1=C2C(=C(C=C1)CN)SC3=CC=CC=C3C2=O. |
| Q: What is the molecular formula of Anticancer agent 4? |
| A: Molecular formula of Anticancer agent 4 is C18H21N3OS. |
| Q: What is the English name of Anticancer agent 4? |
| A: The English name of Anticancer agent 4 is Anticancer agent 4. |
| Q: What is the Chinese name of 153236-38-5? |
| A: Chinese name of 153236-38-5 is 153236-38-5. |
| Q: What is the InChIKey of Anticancer agent 4? |
| A: InChIKey of Anticancer agent 4 is ZHLMWNKEIRSOPZ-UHFFFAOYSA-N. |