Benzenamine,N,N-bis(2-chloroethyl)-4-[[(cyclohexylmethyl)imino]methyl]- structure
|
Common Name | Benzenamine,N,N-bis(2-chloroethyl)-4-[[(cyclohexylmethyl)imino]methyl]- | ||
|---|---|---|---|---|
| CAS Number | 15332-49-7 | Molecular Weight | 341.31800 | |
| Density | 1.13g/cm3 | Boiling Point | 471.9ºC at 760 mmHg | |
| Molecular Formula | C18H26Cl2N2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 239.2ºC | |
| Name | N,N-bis(2-chloroethyl)-4-(cyclohexylmethyliminomethyl)aniline |
|---|---|
| Synonym | More Synonyms |
| Density | 1.13g/cm3 |
|---|---|
| Boiling Point | 471.9ºC at 760 mmHg |
| Molecular Formula | C18H26Cl2N2 |
| Molecular Weight | 341.31800 |
| Flash Point | 239.2ºC |
| Exact Mass | 340.14700 |
| PSA | 15.60000 |
| LogP | 4.96980 |
| Vapour Pressure | 4.49E-09mmHg at 25°C |
| Index of Refraction | 1.558 |
| InChIKey | CKXVYBGPFDPXDH-UHFFFAOYSA-N |
| SMILES | ClCCN(CCCl)c1ccc(C=NCC2CCCCC2)cc1 |
|
~%
Benzenamine,N,N... CAS#:15332-49-7 |
| Literature: Nicole; Berlinguet Journal of medicinal chemistry, 1967 , vol. 10, # 2 p. 287 - 288 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| n,n-bis(2-chloroethyl)-4-{(e)-[(cyclohexylmethyl)imino]methyl}aniline |