Benzenamine,N,N-bis(2-chloroethyl)-4-[[(2-methoxy-5-nitrophenyl)imino]methyl]-3-methyl- structure
|
Common Name | Benzenamine,N,N-bis(2-chloroethyl)-4-[[(2-methoxy-5-nitrophenyl)imino]methyl]-3-methyl- | ||
|---|---|---|---|---|
| CAS Number | 15332-52-2 | Molecular Weight | 410.29400 | |
| Density | 1.26g/cm3 | Boiling Point | 611.4ºC at 760mmHg | |
| Molecular Formula | C19H21Cl2N3O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 323.6ºC | |
| Name | N-bis(2-chloroethyl)-4-[(2-methoxy-5-nitrophenyl)iminomethyl]-3- methylaniline |
|---|
| Density | 1.26g/cm3 |
|---|---|
| Boiling Point | 611.4ºC at 760mmHg |
| Molecular Formula | C19H21Cl2N3O3 |
| Molecular Weight | 410.29400 |
| Flash Point | 323.6ºC |
| Exact Mass | 409.09600 |
| PSA | 70.65000 |
| LogP | 5.46960 |
| Vapour Pressure | 6.86E-15mmHg at 25°C |
| Index of Refraction | 1.577 |
| InChIKey | PGUYSZZOOPCOPM-UHFFFAOYSA-N |
| SMILES | COc1ccc([N+](=O)[O-])cc1N=Cc1ccc(N(CCCl)CCCl)cc1C |
|
~%
Benzenamine,N,N... CAS#:15332-52-2 |
| Literature: Nicole; Berlinguet Journal of medicinal chemistry, 1967 , vol. 10, # 2 p. 287 - 288 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |