3,4-Xylidine, a4,a4'-(propylenedinitrilo)bis[N,N-bis(2-chloroethyl)-(8CI) structure
|
Common Name | 3,4-Xylidine, a4,a4'-(propylenedinitrilo)bis[N,N-bis(2-chloroethyl)-(8CI) | ||
|---|---|---|---|---|
| CAS Number | 15332-59-9 | Molecular Weight | 558.414 | |
| Density | 1.2±0.1 g/cm3 | Boiling Point | 679.7±55.0 °C at 760 mmHg | |
| Molecular Formula | C27H36Cl4N4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 364.9±31.5 °C | |
| Name | 4,4'-{1,2-Propanediylbis[nitrilo(E)methylylidene]}bis[N,N-bis(2-chloroethyl)-3-methylaniline] |
|---|---|
| Synonym | More Synonyms |
| Density | 1.2±0.1 g/cm3 |
|---|---|
| Boiling Point | 679.7±55.0 °C at 760 mmHg |
| Molecular Formula | C27H36Cl4N4 |
| Molecular Weight | 558.414 |
| Flash Point | 364.9±31.5 °C |
| Exact Mass | 556.169434 |
| PSA | 31.20000 |
| LogP | 6.13 |
| Vapour Pressure | 0.0±2.1 mmHg at 25°C |
| Index of Refraction | 1.560 |
| InChIKey | KWDFAEPQSXAGLR-UHFFFAOYSA-N |
| SMILES | Cc1cc(N(CCCl)CCCl)ccc1C=NCC(C)N=Cc1ccc(N(CCCl)CCCl)cc1C |
|
~%
3,4-Xylidine, a... CAS#:15332-59-9 |
| Literature: Nicole; Berlinguet Journal of medicinal chemistry, 1967 , vol. 10, # 2 p. 287 - 288 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| 1,2-Propanediamine, N,N-bis[(1E)-[4-[bis(2-chloroethyl)amino]-2-methylphenyl]methylene]- |
| 4,4'-{1,2-Propanediylbis[nitrilo(E)methylylidene]}bis[N,N-bis(2-chloroethyl)-3-methylaniline] |