3-[3-(2-hydroxyphenyl)-3-oxoprop-1-enyl]chromen-4-one structure
|
Common Name | 3-[3-(2-hydroxyphenyl)-3-oxoprop-1-enyl]chromen-4-one | ||
|---|---|---|---|---|
| CAS Number | 15346-08-4 | Molecular Weight | 292.28500 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C18H12O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 3-[3-(2-hydroxyphenyl)-3-oxoprop-1-enyl]chromen-4-one |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C18H12O4 |
|---|---|
| Molecular Weight | 292.28500 |
| Exact Mass | 292.07400 |
| PSA | 67.51000 |
| LogP | 3.39470 |
| InChIKey | CWHRFUHJIOHWFJ-UHFFFAOYSA-N |
| SMILES | O=C(C=Cc1coc2ccccc2c1=O)c1ccccc1O |
|
~43%
3-[3-(2-hydroxy... CAS#:15346-08-4 |
| Literature: Coutinho, Dionysia L M; Fernandes, Peter S Indian Journal of Chemistry, Section B: Organic Chemistry Including Medicinal Chemistry, 1992 , vol. 31, # 9 p. 573 - 577 |
|
~0%
3-[3-(2-hydroxy... CAS#:15346-08-4
Detail
|
| Literature: Sacquet, Marie-Claude; Fargeau-Bellassoued, Marie Claude; Graffe, Bernadette Journal of Heterocyclic Chemistry, 1991 , vol. 28, # 3 p. 667 - 672 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |
| 3-[3-(2-hydroxy-phenyl)-3-oxo-propenyl]-chromen-4-one |
| 1-Chromonyl-(3)-2-salicoyl-aethylen |
| 3-[3-(2-hydroxyphenyl)-3-oxoprop-1-enyl]-4H-chromen-4-one |
| 4H-1-Benzopyran-4-one,3-[3-(2-hydroxyphenyl)-3-oxo-1-propenyl] |