25,26,26,26,27,27,27-heptafluorocholesterol structure
|
Common Name | 25,26,26,26,27,27,27-heptafluorocholesterol | ||
|---|---|---|---|---|
| CAS Number | 153463-21-9 | Molecular Weight | 512.58700 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C27H39F7O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of 25,26,26,26,27,27,27-heptafluorocholesterolF7-Cholesterol is a fluorinated derivative of cholesterol. It is a cholesterol analog. F7-Cholesterol is useful as helper lipid in conjunction with vectors for DNA transfection. |
| Name | 10,13-dimethyl-17-[6,7,7,7-tetrafluoro-6-(trifluoromethyl)heptan-2-yl]-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-ol |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C27H39F7O |
|---|---|
| Molecular Weight | 512.58700 |
| Exact Mass | 512.28900 |
| PSA | 20.23000 |
| LogP | 8.56560 |
| Vapour Pressure | 1.24E-10mmHg at 25°C |
| InChIKey | DUAIJEYNEJQOCE-QSHWPSJXSA-N |
| SMILES | CC(CCCC(F)(C(F)(F)F)C(F)(F)F)C1CCC2C3CC=C4CC(O)CCC4(C)C3CCC12C |
| Storage condition | 20°C |
| Cholest-5-en-3-ol,25,26,26,26,27,27,27-heptafluoro-,(3b)-(9CI) |