Naphthalene,1-ethoxy-2,4-dinitro- structure
|
Common Name | Naphthalene,1-ethoxy-2,4-dinitro- | ||
|---|---|---|---|---|
| CAS Number | 15352-94-0 | Molecular Weight | 262.21800 | |
| Density | 1.396g/cm3 | Boiling Point | 447.6ºC at 760 mmHg | |
| Molecular Formula | C12H10N2O5 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 210ºC | |
| Name | 1-ethoxy-2,4-dinitronaphthalene |
|---|---|
| Synonym | More Synonyms |
| Density | 1.396g/cm3 |
|---|---|
| Boiling Point | 447.6ºC at 760 mmHg |
| Molecular Formula | C12H10N2O5 |
| Molecular Weight | 262.21800 |
| Flash Point | 210ºC |
| Exact Mass | 262.05900 |
| PSA | 100.87000 |
| LogP | 4.10130 |
| Vapour Pressure | 8.75E-08mmHg at 25°C |
| Index of Refraction | 1.65 |
| InChIKey | QPUOWBJQCAKKAC-UHFFFAOYSA-N |
| SMILES | CCOc1c([N+](=O)[O-])cc([N+](=O)[O-])c2ccccc12 |
| Precursor 9 | |
|---|---|
| DownStream 2 | |
| ethyl-(2,4-dinitro-[1]naphthyl)-ether |
| Aethyl-(2,4-dinitro-[1]naphthyl)-aether |
| 1-ethoxyl-2,4-dinitronaphthalene |
| 2,4-dinitro-1-naphthyl ethyl ether |
| 2.4-Dinitro-naphthol-(1)-aethylaether |
| ethyl ether of 2,4-dinitro-1-naphthol |