2'-O-Methyl-5-Methyl-U CE phosphoramidite structure
|
Common Name | 2'-O-Methyl-5-Methyl-U CE phosphoramidite | ||
|---|---|---|---|---|
| CAS Number | 153631-20-0 | Molecular Weight | 774.83900 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C41H51N4O9P | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of 2'-O-Methyl-5-Methyl-U CE phosphoramidite2'-O-Methyl-5-methyl-U CEP is a uridine, can be used for synthesis nucleic acid. |
| Name | 2'-o-methyl-5-methyl-u cep |
|---|---|
| Synonym | More Synonyms |
| Description | 2'-O-Methyl-5-methyl-U CEP is a uridine, can be used for synthesis nucleic acid. |
|---|---|
| Related Catalog |
| Molecular Formula | C41H51N4O9P |
|---|---|
| Molecular Weight | 774.83900 |
| Exact Mass | 774.33900 |
| PSA | 160.09000 |
| LogP | 6.44448 |
| InChIKey | GMJRPRHRYILEOK-VNZAIEIISA-N |
| SMILES | COc1ccc(C(OCC2OC(n3cc(C)c(=O)[nH]c3=O)C(OC)C2OP(OCCC#N)N(C(C)C)C(C)C)(c2ccccc2)c2ccc(OC)cc2)cc1 |
| Storage condition | 2-8℃ |
| 5'-O-DMT-2'-O-methyl-5-methyluridine 3'-CE phosphoramidite |