Tricyclo[3.3.1.13,7]decane-1-carboxylic acid, 2,2-difluoro-2-sulfoethyl ester, compd. with N-ethyl-N-(1-methylethyl)-2-propanamine (1:1) structure
|
Common Name | Tricyclo[3.3.1.13,7]decane-1-carboxylic acid, 2,2-difluoro-2-sulfoethyl ester, compd. with N-ethyl-N-(1-methylethyl)-2-propanamine (1:1) | ||
|---|---|---|---|---|
| CAS Number | 1536380-33-2 | Molecular Weight | 453.6 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C21H37F2NO5S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | Tricyclo[3.3.1.13,7]decane-1-carboxylic acid, 2,2-difluoro-2-sulfoethyl ester, compd. with N-ethyl-N-(1-methylethyl)-2-propanamine (1:1) |
|---|
| Molecular Formula | C21H37F2NO5S |
|---|---|
| Molecular Weight | 453.6 |
| InChIKey | GSHJLPNBHPAIAE-UHFFFAOYSA-N |
| SMILES | CCN(C(C)C)C(C)C.O=C(OCC(F)(F)S(=O)(=O)O)C12CC3CC(CC(C3)C1)C2 |