tri(propan-2-yl)-prop-1-en-2-yloxysilane structure
|
Common Name | tri(propan-2-yl)-prop-1-en-2-yloxysilane | ||
|---|---|---|---|---|
| CAS Number | 153645-78-4 | Molecular Weight | 214.42000 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C12H26OSi | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | tri(propan-2-yl)-prop-1-en-2-yloxysilane |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C12H26OSi |
|---|---|
| Molecular Weight | 214.42000 |
| Exact Mass | 214.17500 |
| PSA | 9.23000 |
| LogP | 4.71210 |
| InChIKey | WQLOIPJBHZUMDQ-UHFFFAOYSA-N |
| SMILES | C=C(C)O[Si](C(C)C)(C(C)C)C(C)C |
|
~84%
tri(propan-2-yl... CAS#:153645-78-4 |
| Literature: Simchen, Gerhard; Jonas, Simon Journal fuer Praktische Chemie/Chemiker-Zeitung, 1998 , vol. 340, # 6 p. 506 - 512 |
|
~72%
tri(propan-2-yl... CAS#:153645-78-4 |
| Literature: Mikami, Koichi; Kawakami, Yuji; Akiyama, Katsuhiro; Aikawa, Kohsuke Journal of the American Chemical Society, 2007 , vol. 129, # 43 p. 12950 - 12951 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| Silane,[(1-methylethenyl)oxy]tris(1-methylethyl) |
| isopropenyloxy(triisopropyl)silane |