ethyl 2-(bromomethyl)-4,5-dimethoxybenzoate structure
|
Common Name | ethyl 2-(bromomethyl)-4,5-dimethoxybenzoate | ||
|---|---|---|---|---|
| CAS Number | 15365-26-1 | Molecular Weight | 303.14900 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C12H15BrO4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | ethyl 2-(bromomethyl)-4,5-dimethoxybenzoate |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C12H15BrO4 |
|---|---|
| Molecular Weight | 303.14900 |
| Exact Mass | 302.01500 |
| PSA | 44.76000 |
| LogP | 2.77540 |
| InChIKey | FDPCHYSYALFVRT-UHFFFAOYSA-N |
| SMILES | CCOC(=O)c1cc(OC)c(OC)cc1CBr |
| HS Code | 2918990090 |
|---|
| HS Code | 2918990090 |
|---|---|
| Summary | 2918990090. other carboxylic acids with additional oxygen function and their anhydrides, halides, peroxides and peroxyacids; their halogenated, sulphonated, nitrated or nitrosated derivatives. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| Benzoic acid,2-(bromomethyl)-4,5-dimethoxy-,ethyl ester |