9,10-Bis(3,5-dihydroxyphenyl)anthracene structure
|
Common Name | 9,10-Bis(3,5-dihydroxyphenyl)anthracene | ||
|---|---|---|---|---|
| CAS Number | 153715-08-3 | Molecular Weight | 394.41900 | |
| Density | 1.399g/cm3 | Boiling Point | 634.872ºC at 760 mmHg | |
| Molecular Formula | C26H18O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 290.59ºC | |
| Name | 9,10-Bis(3,5-dihydroxyphenyl)anthracene |
|---|---|
| Synonym | More Synonyms |
| Density | 1.399g/cm3 |
|---|---|
| Boiling Point | 634.872ºC at 760 mmHg |
| Molecular Formula | C26H18O4 |
| Molecular Weight | 394.41900 |
| Flash Point | 290.59ºC |
| Exact Mass | 394.12100 |
| PSA | 80.92000 |
| LogP | 6.14940 |
| Vapour Pressure | 0mmHg at 25°C |
| Index of Refraction | 1.783 |
| InChIKey | BTBBWVMITMIXSY-UHFFFAOYSA-N |
| SMILES | Oc1cc(O)cc(-c2c3ccccc3c(-c3cc(O)cc(O)c3)c3ccccc23)c1 |
| HS Code | 2907299090 |
|---|
| HS Code | 2907299090 |
|---|---|
| Summary | 2907299090 polyphenols; phenol-alcohols。supervision conditions:AB(certificate of inspection for goods inward,certificate of inspection for goods outward)。VAT:17.0%。tax rebate rate:9.0%。MFN tariff:5.5%。general tariff:30.0% |
| 5-[10-(3,5-dihydroxyphenyl)anthracen-9-yl]benzene-1,3-diol |
| 9,10-BIS(3,5-DIHYDROXYPHENYL)ANTHRACENE |