(8S,10S,13S,14S)-10,13-dimethyl-7,8,12,14,15,16-hexahydro-6H-cyclopenta[a]phenanthrene-3,17-dione structure
|
Common Name | (8S,10S,13S,14S)-10,13-dimethyl-7,8,12,14,15,16-hexahydro-6H-cyclopenta[a]phenanthrene-3,17-dione | ||
|---|---|---|---|---|
| CAS Number | 15375-21-0 | Molecular Weight | 282.37700 | |
| Density | 1.168g/cm3 | Boiling Point | 454.188ºC at 760 mmHg | |
| Molecular Formula | C19H22O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 169.149ºC | |
| Name | (8S,10S,13S,14S)-10,13-dimethyl-7,8,12,14,15,16-hexahydro-6H-cyclopenta[a]phenanthrene-3,17-dione |
|---|---|
| Synonym | More Synonyms |
| Density | 1.168g/cm3 |
|---|---|
| Boiling Point | 454.188ºC at 760 mmHg |
| Molecular Formula | C19H22O2 |
| Molecular Weight | 282.37700 |
| Flash Point | 169.149ºC |
| Exact Mass | 282.16200 |
| PSA | 34.14000 |
| LogP | 3.78350 |
| Vapour Pressure | 0mmHg at 25°C |
| Index of Refraction | 1.588 |
| InChIKey | NNPWVPDIRNJLIN-LNMJFAINSA-N |
| SMILES | CC12C=CC(=O)C=C1CCC1C2=CCC2(C)C(=O)CCC12 |
|
~%
(8S,10S,13S,14S... CAS#:15375-21-0 |
| Literature: Robinson et al. Journal of the American Chemical Society, 1959 , vol. 81, p. 2195,2197, 2198 |
| Precursor 1 | |
|---|---|
| DownStream 2 | |
| 3,17-Dioxoandrosta-1,4,9(11)-trien |
| 1,4,9(11)-androstatriene-3,17-dione |
| Androsta-1,4,9(11)-trien-3,17-dion |
| 1,4,9-Androstatriene-3-17-dione |
| androsta-1,4,9-triene-3,17-dione |
| androsta-1,4,9(11)-trien-3,17-dione |
| androsta-1,4,9(11)-triene-3,17-dione |
| 1,4,9(11)-Androstatrien-3,17-dion |