7-(4-Fluorophenyl)-1H-indole structure
|
Common Name | 7-(4-Fluorophenyl)-1H-indole | ||
|---|---|---|---|---|
| CAS Number | 153758-21-5 | Molecular Weight | 211.23400 | |
| Density | 1.232g/cm3 | Boiling Point | 389.1ºC at 760 mmHg | |
| Molecular Formula | C14H10FN | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 189.1ºC | |
| Name | 7-(4-Fluorophenyl)-1H-indole |
|---|---|
| Synonym | More Synonyms |
| Density | 1.232g/cm3 |
|---|---|
| Boiling Point | 389.1ºC at 760 mmHg |
| Molecular Formula | C14H10FN |
| Molecular Weight | 211.23400 |
| Flash Point | 189.1ºC |
| Exact Mass | 211.08000 |
| PSA | 15.79000 |
| LogP | 3.97400 |
| Vapour Pressure | 6.55E-06mmHg at 25°C |
| Index of Refraction | 1.658 |
| InChIKey | NJPOTRCQJRBMIR-UHFFFAOYSA-N |
| SMILES | Fc1ccc(-c2cccc3cc[nH]c23)cc1 |
|
~85%
7-(4-Fluorophen... CAS#:153758-21-5 |
| Literature: ELI LILLY AND COMPANY Patent: WO2004/67529 A1, 2004 ; Location in patent: Page 74 ; WO 2004/067529 A1 |
| 7-(4-fluoro-phenyl)-1H-indole |
| 7-(4-fluorobenzyloxy)-2,3-dimethyl-1H-pyrrolo[3,2-c]pyridine |
| 1H-Pyrrolo[3,2-c]pyridine,7-[(4-fluorophenyl)methoxy]-2,3-dimethyl |