4-Carbamimidoyl-piperazine-1-carboxylic acid tert-butyl ester structure
|
Common Name | 4-Carbamimidoyl-piperazine-1-carboxylic acid tert-butyl ester | ||
|---|---|---|---|---|
| CAS Number | 153836-14-7 | Molecular Weight | 228.29100 | |
| Density | 1.22g/cm3 | Boiling Point | 328.4ºC at 760 mmHg | |
| Molecular Formula | C10H20N4O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 152.4ºC | |
| Name | Tert-Butyl 4-Carbamimidoylpiperazine-1-Carboxylate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.22g/cm3 |
|---|---|
| Boiling Point | 328.4ºC at 760 mmHg |
| Molecular Formula | C10H20N4O2 |
| Molecular Weight | 228.29100 |
| Flash Point | 152.4ºC |
| Exact Mass | 228.15900 |
| PSA | 82.65000 |
| LogP | 1.10840 |
| Vapour Pressure | 0.00019mmHg at 25°C |
| Index of Refraction | 1.555 |
| InChIKey | MJNAHJKRZWPBSX-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N1CCN(C(=N)N)CC1 |
| HS Code | 2933599090 |
|---|
| HS Code | 2933599090 |
|---|---|
| Summary | 2933599090. other compounds containing a pyrimidine ring (whether or not hydrogenated) or piperazine ring in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| tert-Butyl 4-carbamimidoylpiperazine-1-carboxylate |